Probe Summary
| Targets | Biochemical/Biophysical Potency | Cellular Potency |
|---|---|---|
| TEAD1 |
|
|
| TEAD2 |
| |
| TEAD3 |
| |
| TEAD4 |
|
Selectivity
Potency: GI50
Potency Cellular
In Vitro
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1158/1535-7163.MCT-20-0717
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1158/1535-7163.MCT-20-0717
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1158/1535-7163.MCT-20-0717
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1158/1535-7163.MCT-20-0717
In Vivo Validations
DOI Reference: 10.1158/1535-7163.MCT-20-0717
Negative Control Compounds
Orthogonal Probes def
Chemical Information
| Molecular Formula | C25H19F3N2O |
| SMILEs | C[C@H](NC(=O)c1ccc2c(-c3ccc(C(F)(F)F)cc3)cccc2c1)c1ccccn1 |
| InChI | InChI=1S/C25H19F3N2O/c1-16(23-7-2-3-14-29-23)30-24(31)19-10-13-22-18(15-19)5-4-6-21(22)17-8-11-20(12-9-17)25(26,27)28/h2-16H,1H3,(H,30,31)/t16-/m0/s1 |
| Molecular weight | 420.14 Da |
| AlogP | 0.0 |
| HBond acceptors | 3 |
| HBond donors | 1 |
| Atoms | 50 |
Vendors
Note: This is not an exhaustive list and does not indicate endorsement by the portal.