Probe Summary
| Targets | Biochemical/Biophysical Potency | Cellular Potency |
|---|---|---|
| BACE1 |
|
|
| BACE2 |
|
Selectivity
Potency Cellular
In Vitro
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1021/acs.jmedchem.6b00307
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1021/acs.jmedchem.6b00307
In Vivo Validations
DOI Reference: 10.1021/acs.jmedchem.6b00307
DOI Reference: 10.1021/acs.jmedchem.6b00307
DOI Reference: 10.1021/acs.jmedchem.6b00307
DOI Reference: 10.1021/acs.jmedchem.6b00307
DOI Reference: 10.1021/acs.jmedchem.6b00307
DOI Reference: 10.1021/acs.jmedchem.6b00307
Chemical Information
| Molecular Formula | C17H17F2N5O3S |
| SMILEs | CN1C(=N)N[C@](C)(c2cc(NC(=O)c3ccc(F)cn3)ccc2F)CS1(=O)=O |
| InChI | InChI=1S/C17H17F2N5O3S/c1-17(9-28(26,27)24(2)16(20)23-17)12-7-11(4-5-13(12)19)22-15(25)14-6-3-10(18)8-21-14/h3-8H,9H2,1-2H3,(H2,20,23)(H,22,25)/t17-/m0/s1 |
| Molecular weight | 409.10 Da |
| AlogP | 1.6268700000000005 |
| HBond acceptors | 8 |
| HBond donors | 3 |
| Atoms | 45 |