Probe Summary
| Targets | Biochemical/Biophysical Potency | Cellular Potency |
|---|---|---|
| CBX7 |
|
|
| CBX4 |
|
|
Selectivity
Potency: KD - CBX2: 1.8 uM, CBX6: 0.610 uM, CBX8: 1.2 uM, CDY1: 6.3 uM, CDYL1b: 0.91 uM, CDYL2: 0.85 uM
Potency:
Potency Cellular
In Vitro
Mode of Action: Antagonist
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1038/nchembio.2007
Mode of Action: Antagonist
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1038/nchembio.2007
Negative Control Compounds
Chemical Information
| Molecular Formula | C43H66N6O8 |
| SMILEs | CCN(CC)CCCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](C)NC(=O)[C@H](Cc1ccccc1)NC(=O)c1ccc(C(C)(C)C)cc1)C(=O)N[C@@H](CO)C(=O)OC |
| InChI | InChI=1S/C43H66N6O8/c1-10-49(11-2)24-16-15-19-33(39(53)48-36(27-50)42(56)57-9)45-41(55)34(25-28(3)4)46-37(51)29(5)44-40(54)35(26-30-17-13-12-14-18-30)47-38(52)31-20-22-32(23-21-31)43(6,7)8/h12-14,17-18,20-23,28-29,33-36,50H,10-11,15-16,19,24-27H2,1-9H3,(H,44,54)(H,45,55)(H,46,51)(H,47,52)(H,48,53)/t29-,33-,34-,35-,36-/m0/s1 |
| Molecular weight | 794.49 Da |
| AlogP | 3.0078 |
| HBond acceptors | 14 |
| HBond donors | 6 |
| Atoms | 123 |
Vendors
Note: This is not an exhaustive list and does not indicate endorsement by the portal.