Probe Summary
| Targets | Biochemical/Biophysical Potency | Cellular Potency |
|---|---|---|
| MERTK |
|
|
| AXL |
|
|
Selectivity
Potency Cellular
In Vitro
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1021/acs.jmedchem.4c00148
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1021/acs.jmedchem.4c00148
In Vivo Validations
DOI Reference: 10.1021/acs.jmedchem.4c00148
DOI Reference: 10.1021/acs.jmedchem.4c00148
DOI Reference: 10.1021/acs.jmedchem.4c00148
DOI Reference: 10.1021/acs.jmedchem.4c00148
Chemical Information
| Molecular Formula | C29H41N7O3 |
| SMILEs | CCN(CC)CCNC(=O)[C@H]1CC[C@H](NC(=O)c2cnc3nc2Nc2ccc(C)c(c2)OC/C=C\CN3)CC1 |
| InChI | InChI=1S/C29H41N7O3/c1-4-36(5-2)16-15-30-27(37)21-9-12-22(13-10-21)34-28(38)24-19-32-29-31-14-6-7-17-39-25-18-23(11-8-20(25)3)33-26(24)35-29/h6-8,11,18-19,21-22H,4-5,9-10,12-17H2,1-3H3,(H,30,37)(H,34,38)(H2,31,32,33,35)/b7-6-/t21-,22- |
| Molecular weight | 535.33 Da |
| AlogP | 3.635720000000001 |
| HBond acceptors | 10 |
| HBond donors | 4 |
| Atoms | 80 |
Vendors
Note: This is not an exhaustive list and does not indicate endorsement by the portal.