Probe Summary
| Targets | Biochemical/Biophysical Potency | Cellular Potency |
|---|---|---|
| KDM4A |
| |
| KDM4B |
| |
| KDM4C |
|
|
| KDM4D |
|
Selectivity
Potency Cellular
In Vitro
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? No
DOI Reference: 10.1097/CAD.0000000000001514
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1097/CAD.0000000000001514
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1097/CAD.0000000000001514
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? No
DOI Reference: 10.1097/CAD.0000000000001514
Chemical Information
| Molecular Formula | C26H29N3O3 |
| SMILEs | CC(C)c1ccc(N(C)c2ccc3c(c2)OCC[C@H]3CNc2cnccc2C(=O)O)cc1 |
| InChI | InChI=1S/C26H29N3O3/c1-17(2)18-4-6-20(7-5-18)29(3)21-8-9-22-19(11-13-32-25(22)14-21)15-28-24-16-27-12-10-23(24)26(30)31/h4-10,12,14,16-17,19,28H,11,13,15H2,1-3H3,(H,30,31)/t19-/m0/s1 |
| Molecular weight | 431.22 Da |
| AlogP | 5.649300000000005 |
| HBond acceptors | 6 |
| HBond donors | 2 |
| Atoms | 61 |