Probe Summary
| Targets | Biochemical/Biophysical Potency | Cellular Potency |
|---|---|---|
| SRC |
|
|
| YES1 |
|
|
| LYN |
|
|
| FYN |
|
|
Selectivity
Potency Cellular
In Vitro
Mode of Action: ATP Competitive
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1128/mcb.20.23.9018-9027.2000
Mode of Action: ATP Competitive
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1128/mcb.20.23.9018-9027.2000
Mode of Action: ATP Competitive
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1128/mcb.20.23.9018-9027.2000
Mode of Action: ATP Competitive
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1128/mcb.20.23.9018-9027.2000
In Vivo Validations
Orthogonal Probes def
Chemical Information
| Molecular Formula | C19H21N3O3S |
| SMILEs | CN(C)S(=O)(=O)c1ccc2c(c1)/C(=C/c1cc3c([nH]1)CCCC3)C(=O)N2 |
| InChI | InChI=1S/C19H21N3O3S/c1-22(2)26(24,25)14-7-8-18-15(11-14)16(19(23)21-18)10-13-9-12-5-3-4-6-17(12)20-13/h7-11,20H,3-6H2,1-2H3,(H,21,23)/b16-10- |
| Molecular weight | 371.13 Da |
| AlogP | 2.6365000000000007 |
| HBond acceptors | 6 |
| HBond donors | 2 |
| Atoms | 47 |
Vendors
Note: This is not an exhaustive list and does not indicate endorsement by the portal.