Probe Summary
| Targets | Biochemical/Biophysical Potency | Cellular Potency |
|---|---|---|
| HDAC1 |
|
|
| HDAC2 |
|
|
| HDAC3 |
|
|
| HDAC8 |
|
|
Selectivity
Potency: IC50 - HDAC4: 510 nM, HDAC6: 14,000 nM
Potency Cellular
In Vitro
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1038/nchembio.313
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1038/nchembio.313
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1038/nchembio.313
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1038/nchembio.313
Chemical Information
| Molecular Formula | C24H36N4O6S2 |
| SMILEs | C/C=C1\NC(=O)[C@H]2CSSCC/C=C/[C@H](CC(=O)N[C@H](C(C)C)C(=O)N2)OC(=O)[C@H](C(C)C)NC1=O |
| InChI | InChI=1S/C24H36N4O6S2/c1-6-16-21(30)28-20(14(4)5)24(33)34-15-9-7-8-10-35-36-12-17(22(31)25-16)26-23(32)19(13(2)3)27-18(29)11-15/h6-7,9,13-15,17,19-20H,8,10-12H2,1-5H3,(H,25,31)(H,26,32)(H,27,29)(H,28,30)/b9-7+,16-6-/t15-,17-,19-,20+/m1/s1 |
| Molecular weight | 540.21 Da |
| AlogP | 1.4296 |
| HBond acceptors | 10 |
| HBond donors | 4 |
| Atoms | 72 |
Vendors
Note: This is not an exhaustive list and does not indicate endorsement by the portal.