Probe Summary
| Targets | Biochemical/Biophysical Potency | Cellular Potency |
|---|---|---|
| PIK3CA |
|
|
| PIK3CD |
|
|
Selectivity
Potency: IC50 - PIK3CB 0.033 uM, PIK3CD 0.075 uM, C2 beta 0.67 uM, VPS34 >10 uM, DNA-PK 1.23 uM, MTOR Ki(app) = 0.58 uM
Potency Cellular
In Vitro
Mode of Action: ATP competitive
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1021/jm800295d
Mode of Action: ATP competitive
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1021/jm800295d
In Vivo Validations
DOI Reference: 10.1021/jm800295d
Chemical Information
| Molecular Formula | C23H27N7O3S2 |
| SMILEs | CS(=O)(=O)N1CCN(Cc2cc3nc(-c4cccc5[nH]ncc45)nc(N4CCOCC4)c3s2)CC1 |
| InChI | InChI=1S/C23H27N7O3S2/c1-35(31,32)30-7-5-28(6-8-30)15-16-13-20-21(34-16)23(29-9-11-33-12-10-29)26-22(25-20)17-3-2-4-19-18(17)14-24-27-19/h2-4,13-14H,5-12,15H2,1H3,(H,24,27) |
| Molecular weight | 513.16 Da |
| AlogP | 0.0 |
| HBond acceptors | 10 |
| HBond donors | 1 |
| Atoms | 62 |
References
Publications
Vendors
Note: This is not an exhaustive list and does not indicate endorsement by the portal.