Probe Summary
| Targets | Biochemical/Biophysical Potency | Cellular Potency |
|---|---|---|
| PAK1 |
|
|
| PAK4 |
|
|
| PAK5 |
|
|
| PAK6 |
|
|
Selectivity
Potency Cellular
In Vitro
Mode of Action: ATP competitive
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1073/pnas.0911863107
Mode of Action: ATP competitive
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1073/pnas.0911863107
Mode of Action: ATP competitive
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1073/pnas.0911863107
Mode of Action: ATP competitive
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1073/pnas.0911863107
In Vivo Validations
DOI Reference: 10.1073/pnas.0911863107
Orthogonal Probes def
Chemical Information
| Molecular Formula | C25H30N8OS |
| SMILEs | Cc1nc(Nc2[nH]nc3c2CN(C(=O)N[C@H](CN(C)C)c2ccccc2)C3(C)C)c2sccc2n1 |
| InChI | InChI=1S/C25H30N8OS/c1-15-26-18-11-12-35-20(18)23(27-15)29-22-17-13-33(25(2,3)21(17)30-31-22)24(34)28-19(14-32(4)5)16-9-7-6-8-10-16/h6-12,19H,13-14H2,1-5H3,(H,28,34)(H2,26,27,29,30,31)/t19-/m1/s1 |
| Molecular weight | 490.23 Da |
| AlogP | 0.0 |
| HBond acceptors | 9 |
| HBond donors | 3 |
| Atoms | 65 |
Vendors
Note: This is not an exhaustive list and does not indicate endorsement by the portal.