Probe Summary
| Targets | Biochemical/Biophysical Potency | Cellular Potency |
|---|---|---|
| SLC34A1 |
|
|
Selectivity
Potency: IC50
Potency Cellular
In Vitro
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? No
DOI Reference: 10.1021/acsmedchemlett.8b00013
In Vivo Validations
DOI Reference: 10.1021/acsmedchemlett.8b00013
DOI Reference: 10.1021/acsmedchemlett.8b00013
DOI Reference: 10.1021/acsmedchemlett.8b00013
DOI Reference: 10.1021/acsmedchemlett.8b00013
DOI Reference: 10.1021/acsmedchemlett.8b00013
DOI Reference: 10.1021/acsmedchemlett.8b00013
Chemical Information
| Molecular Formula | C15H14ClF3N4O2 |
| SMILEs | Cc1[nH]c2c(N3CCO[C@H](CO)C3)c(C#N)c(C(F)(F)F)nc2c1Cl |
| InChI | InChI=1S/C15H14ClF3N4O2/c1-7-10(16)11-12(21-7)13(23-2-3-25-8(5-23)6-24)9(4-20)14(22-11)15(17,18)19/h8,21,24H,2-3,5-6H2,1H3/t8-/m0/s1 |
| Molecular weight | 374.08 Da |
| AlogP | 2.612700000000001 |
| HBond acceptors | 6 |
| HBond donors | 2 |
| Atoms | 39 |
Vendors
Note: This is not an exhaustive list and does not indicate endorsement by the portal.