Probe Summary
| Targets | Biochemical/Biophysical Potency | Cellular Potency |
|---|---|---|
| JAK1 |
|
|
| JAK2 |
|
|
| JAK3 |
| |
| TYK2 |
|
Selectivity
Potency Cellular
In Vitro
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1021/acs.jmedchem.6b01634
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1021/acs.jmedchem.6b01634
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1021/acs.jmedchem.6b01634
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1021/acs.jmedchem.6b01634
In Vivo Validations
DOI Reference: 10.1021/acs.jmedchem.6b01634
DOI Reference: 10.1021/acs.jmedchem.6b01634
DOI Reference: 10.1021/acs.jmedchem.6b01634
Chemical Information
| Molecular Formula | C31H31FN8O2 |
| SMILEs | CCc1cc(O)c(F)cc1-c1ccc2c(-c3nc4c([nH]3)CCN(C(=O)c3cnc(N5CCCCC5)cn3)C4)n[nH]c2c1 |
| InChI | InChI=1S/C31H31FN8O2/c1-2-18-13-27(41)22(32)14-21(18)19-6-7-20-24(12-19)37-38-29(20)30-35-23-8-11-40(17-26(23)36-30)31(42)25-15-34-28(16-33-25)39-9-4-3-5-10-39/h6-7,12-16,41H,2-5,8-11,17H2,1H3,(H,35,36)(H,37,38) |
| Molecular weight | 566.26 Da |
| AlogP | 5.0059 |
| HBond acceptors | 10 |
| HBond donors | 3 |
| Atoms | 73 |
Vendors
Note: This is not an exhaustive list and does not indicate endorsement by the portal.