Probe Summary
| Targets | Biochemical/Biophysical Potency | Cellular Potency |
|---|---|---|
| PADI1 |
| |
| PADI2 |
| |
| PADI3 |
| |
| PADI4 |
|
|
Selectivity
Potency Cellular
In Vitro
Mode of Action: allosteric
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1038/s41467-025-59919-4
Mode of Action: allosteric
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1038/s41467-025-59919-4
Mode of Action: allosteric
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1038/s41467-025-59919-4
Mode of Action: allosteric
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1038/s41467-025-59919-4
Negative Control Compounds
Notes: The enantiomer of PAD-PF2 (ent-PAD-PF2) shows an IC50 = 26.0 µM in FQ assay.
Chemical Information
| Molecular Formula | C25H27Cl2N5O |
| SMILEs | N[C@H](C(=O)N1CCCC1)C1CCN(c2nccc3c(-c4ncc(Cl)cc4Cl)cccc23)CC1 |
| InChI | InChI=1S/C25H27Cl2N5O/c26-17-14-21(27)23(30-15-17)19-4-3-5-20-18(19)6-9-29-24(20)31-12-7-16(8-13-31)22(28)25(33)32-10-1-2-11-32/h3-6,9,14-16,22H,1-2,7-8,10-13,28H2/t22-/m0/s1 |
| Molecular weight | 483.16 Da |
| AlogP | 4.769700000000004 |
| HBond acceptors | 6 |
| HBond donors | 2 |
| Atoms | 60 |