Probe Summary
| Targets | Biochemical/Biophysical Potency | Cellular Potency |
|---|---|---|
| PIK3CA |
|
|
| PIK3CB |
|
|
| PIK3CG |
|
|
Selectivity
Potency Cellular
In Vitro
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1021/acs.jmedchem.2c00267
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1021/acs.jmedchem.2c00267
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1021/acs.jmedchem.2c00267
In Vivo Validations
DOI Reference: 10.1021/acs.jmedchem.2c00267
DOI Reference: 10.1021/acs.jmedchem.2c00267
DOI Reference: 10.1021/acs.jmedchem.2c00267
Negative Control Compounds
Notes: cpd 16: Activity against PIK3 IC50s 1170 nM (Alpha), 8220 nM (Beta), 5220 nM (Gamma)
Chemical Information
| Molecular Formula | C19H21F3N6O4 |
| SMILEs | C[C@H]1OC(=O)C(c2cc(-c3cnc(N)nc3C(F)(F)F)nc(N3CCOCC3)n2)[C@H]1CO |
| InChI | InChI=1S/C19H21F3N6O4/c1-9-11(8-29)14(16(30)32-9)13-6-12(25-18(26-13)28-2-4-31-5-3-28)10-7-24-17(23)27-15(10)19(20,21)22/h6-7,9,11,14,29H,2-5,8H2,1H3,(H2,23,24,27)/t9-,11+,14?/m1/s1 |
| Molecular weight | 454.16 Da |
| AlogP | 0.0 |
| HBond acceptors | 10 |
| HBond donors | 3 |
| Atoms | 53 |