Probe Summary
| Targets | Biochemical/Biophysical Potency | Cellular Potency |
|---|---|---|
| FLT1 |
|
|
| KDR |
|
|
| FLT4 |
|
|
Selectivity
Potency Cellular
In Vitro
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1158/0008-5472.CAN-05-4290
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1158/0008-5472.CAN-05-4290
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1158/0008-5472.CAN-05-4290
In Vivo Validations
DOI Reference: 10.1158/0008-5472.CAN-05-4290
DOI Reference: 10.1158/0008-5472.CAN-05-4290
DOI Reference: 10.1158/0008-5472.CAN-05-4290
DOI Reference: 10.1158/0008-5472.CAN-05-4290
Chemical Information
| Molecular Formula | C22H19ClN4O5 |
| SMILEs | COc1cc2nccc(Oc3ccc(NC(=O)Nc4cc(C)on4)c(Cl)c3)c2cc1OC |
| InChI | InChI=1S/C22H19ClN4O5/c1-12-8-21(27-32-12)26-22(28)25-16-5-4-13(9-15(16)23)31-18-6-7-24-17-11-20(30-3)19(29-2)10-14(17)18/h4-11H,1-3H3,(H2,25,26,27,28) |
| Molecular weight | 454.10 Da |
| AlogP | 0.0 |
| HBond acceptors | 9 |
| HBond donors | 2 |
| Atoms | 51 |
Vendors
Note: This is not an exhaustive list and does not indicate endorsement by the portal.