Probe Summary
| Targets | Biochemical/Biophysical Potency | Cellular Potency |
|---|---|---|
| BRD4 |
|
|
| BRD2 |
|
|
| BRD3 |
|
Selectivity
Potency Cellular
In Vitro
Mode of Action: Antagonist
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1038/nature10509
Mode of Action: Antagonist
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1038/nature10509
Mode of Action: Antagonist
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1038/nature10509
In Vivo Validations
DOI Reference: 10.1038/nature10509
Orthogonal Probes def
Chemical Information
| Molecular Formula | C23H21N5O3 |
| SMILEs | COc1cc2c(cc1-c1c(C)noc1C)ncc1[nH]c(=O)n([C@H](C)c3ccccn3)c12 |
| InChI | InChI=1S/C23H21N5O3/c1-12-21(14(3)31-27-12)16-9-18-15(10-20(16)30-4)22-19(11-25-18)26-23(29)28(22)13(2)17-7-5-6-8-24-17/h5-11,13H,1-4H3,(H,26,29)/t13-/m1/s1 |
| Molecular weight | 415.16 Da |
| AlogP | 0.0 |
| HBond acceptors | 8 |
| HBond donors | 1 |
| Atoms | 52 |
Vendors
- Cayman (1300031-49-5)
- MedChem Express (1300031-49-5)
- MCULE
- MilliporeSigma (1300031-49-5)
- Tocris (1300031-49-5)
Note: This is not an exhaustive list and does not indicate endorsement by the portal.