Probe Summary
| Targets | Biochemical/Biophysical Potency | Cellular Potency |
|---|---|---|
| BRD2 |
|
|
| BRD3 |
| |
| BRD4 |
| |
| BRDT |
|
Selectivity
Potency Cellular
In Vitro
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1021/acs.jmedchem.0c00614
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? No
DOI Reference: 10.1021/acs.jmedchem.0c00614
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? No
DOI Reference: 10.1021/acs.jmedchem.0c00614
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? No
DOI Reference: 10.1021/acs.jmedchem.0c00614
Negative Control Compounds
Notes: GSK791 BET mutant TR-FRET assay: BRD2 (BD1) pIC50 = 5.6; (BD2) 4.8 BRD3 (BD1) pIC50 = 5.4; (BD2) 4.7 BRD4 (BD1) pIC50 = 5.8; (BD2) 4.5 BRDT (BD1) pIC50 = 5.2; (BD2) 5.1 Clean GPCR scan except for one off-target: GABAA/BZP (Ki = 2539.22 nM)
Chemical Information
| Molecular Formula | C26H33N5O3 |
| SMILEs | Cc1cc2c(-c3ccco3)cnc(N[C@@H]3CCN(C)C[C@H]3C(=O)NC3CCCCC3)c2[nH]c1=O |
| InChI | InChI=1S/C26H33N5O3/c1-16-13-18-19(22-9-6-12-34-22)14-27-24(23(18)30-25(16)32)29-21-10-11-31(2)15-20(21)26(33)28-17-7-4-3-5-8-17/h6,9,12-14,17,20-21H,3-5,7-8,10-11,15H2,1-2H3,(H,27,29)(H,28,33)(H,30,32)/t20-,21-/m1/s1 |
| Molecular weight | 463.26 Da |
| AlogP | 3.672620000000002 |
| HBond acceptors | 8 |
| HBond donors | 3 |
| Atoms | 67 |