Probe Summary
| Targets | Biochemical/Biophysical Potency | Cellular Potency |
|---|---|---|
| PIK3CA |
|
|
| PIK3CB |
| |
| PIK3CG |
| |
| PIK3CD |
| |
| MTOR |
|
Selectivity
Potency Cellular
In Vitro
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1021/jm2009327
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1021/jm2009327
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1021/jm2009327
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1021/jm2009327
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1021/jm2009327
In Vivo Validations
DOI Reference: 10.1021/jm2009327
DOI Reference: 10.1021/jm2009327
DOI Reference: 10.1021/jm2009327
Chemical Information
| Molecular Formula | C23H30N8O3S |
| SMILEs | Cc1c(CN2CCN(C(=O)[C@H](C)O)CC2)sc2c(N3CCOCC3)nc(-c3cnc(N)nc3)nc12 |
| InChI | InChI=1S/C23H30N8O3S/c1-14-17(13-29-3-5-31(6-4-29)22(33)15(2)32)35-19-18(14)27-20(16-11-25-23(24)26-12-16)28-21(19)30-7-9-34-10-8-30/h11-12,15,32H,3-10,13H2,1-2H3,(H2,24,25,26)/t15-/m0/s1 |
| Molecular weight | 498.22 Da |
| AlogP | 0.0 |
| HBond acceptors | 11 |
| HBond donors | 3 |
| Atoms | 65 |
Vendors
Note: This is not an exhaustive list and does not indicate endorsement by the portal.