Probe Summary
| Targets | Biochemical/Biophysical Potency | Cellular Potency |
|---|---|---|
| AURKA |
|
|
| AURKB |
|
|
| AURKC |
|
Selectivity
Gene ID: O00444
Organism: Homo sapiens
Family: Ser/Thr protein kinase family
Potency: IC50 - 82 nM
Potency Cellular
In Vitro
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1016/j.bmcl.2017.08.016
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1016/j.bmcl.2017.08.016
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1016/j.bmcl.2017.08.016
Chemical Information
| Molecular Formula | C30H29N7O3 |
| SMILEs | CCC(=O)Nc1ccc(C(=O)Nc2ccc(Nc3ncc4c(n3)N(C)c3ccc(C)cc3C(=O)N4C)cc2)cc1 |
| InChI | InChI=1S/C30H29N7O3/c1-5-26(38)32-20-9-7-19(8-10-20)28(39)33-21-11-13-22(14-12-21)34-30-31-17-25-27(35-30)36(3)24-15-6-18(2)16-23(24)29(40)37(25)4/h6-17H,5H2,1-4H3,(H,32,38)(H,33,39)(H,31,34,35) |
| Molecular weight | 535.23 Da |
| AlogP | 5.48732 |
| HBond acceptors | 10 |
| HBond donors | 3 |
| Atoms | 69 |