Probe Summary
| Targets | Biochemical/Biophysical Potency | Cellular Potency |
|---|---|---|
| FGFR1 |
|
|
| FGFR2 |
| |
| FGFR3 |
|
|
| FGFR4 |
|
Selectivity
Potency Cellular
In Vitro
Mode of Action: Covalent Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1016/j.chembiol.2010.02.007
Mode of Action: Covalent Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1016/j.chembiol.2010.02.007
Mode of Action: Covalent Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1016/j.chembiol.2010.02.007
Mode of Action: Covalent Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1016/j.chembiol.2010.02.007
Negative Control Compounds
Notes: FRIN-1 is 24-fold less potent against Tel-FGFR1 (EC50 = 340 nM) and 100-fold less potent against Tel-FGFR3 (EC50 = 1040 nM)-transformed Ba/F3 cells. Assay of recombinant FGFR1 measured in Z′-lyte format demonstrated that FIIN-1 is approximately 2.3 times more potent than FRIN-1 in vitro.
Chemical Information
| Molecular Formula | C32H39Cl2N7O4 |
| SMILEs | C=CC(=O)Nc1cccc(CN2C(=O)N(c3c(Cl)c(OC)cc(OC)c3Cl)Cc3cnc(NCCCCN(CC)CC)nc32)c1 |
| InChI | InChI=1S/C32H39Cl2N7O4/c1-6-26(42)37-23-13-11-12-21(16-23)19-41-30-22(18-36-31(38-30)35-14-9-10-15-39(7-2)8-3)20-40(32(41)43)29-27(33)24(44-4)17-25(45-5)28(29)34/h6,11-13,16-18H,1,7-10,14-15,19-20H2,2-5H3,(H,37,42)(H,35,36,38) |
| Molecular weight | 655.24 Da |
| AlogP | 6.6058 |
| HBond acceptors | 11 |
| HBond donors | 2 |
| Atoms | 84 |