Probe Summary
| Targets | Biochemical/Biophysical Potency | Cellular Potency |
|---|---|---|
| DDR1 |
|
|
| DDR2 |
|
|
| NTRK1 |
|
|
| NTRK2 |
|
|
| NTRK3 |
|
Selectivity
Potency Cellular
In Vitro
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? No
DOI Reference: 10.1021/acs.jmedchem.6b00140
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1021/acs.jmedchem.6b00140
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1021/acs.jmedchem.6b00140
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1021/acs.jmedchem.6b00140
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1021/acs.jmedchem.6b00140
In Vivo Validations
DOI Reference: 10.1021/acs.jmedchem.6b00140
DOI Reference: 10.1021/acs.jmedchem.6b00140
DOI Reference: 10.1021/acs.jmedchem.6b00140
DOI Reference: 10.1021/acs.jmedchem.6b00140
Negative Control Compounds
Chemical Information
| Molecular Formula | C26H23F3N6O |
| SMILEs | Cc1cn(-c2cc(NC(=O)c3ccc4c(c3)CN(c3cncnc3)C[C@@H]4C)cc(C(F)(F)F)c2)cn1 |
| InChI | InChI=1S/C26H23F3N6O/c1-16-11-34(23-9-30-14-31-10-23)13-19-5-18(3-4-24(16)19)25(36)33-21-6-20(26(27,28)29)7-22(8-21)35-12-17(2)32-15-35/h3-10,12,14-16H,11,13H2,1-2H3,(H,33,36)/t16-/m0/s1 |
| Molecular weight | 492.19 Da |
| AlogP | 5.365520000000004 |
| HBond acceptors | 7 |
| HBond donors | 1 |
| Atoms | 59 |