Probe Summary
| Targets | Biochemical/Biophysical Potency | Cellular Potency |
|---|---|---|
| BRD2 |
|
|
| BRD4 |
|
|
| BRD3 |
|
|
| BRDT |
|
|
Selectivity
Potency Cellular
In Vitro
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1021/acs.jmedchem.5b01882
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1021/acs.jmedchem.5b01882
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1021/acs.jmedchem.5b01882
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? No
DOI Reference: 10.1021/acs.jmedchem.5b01882
In Vivo Validations
DOI Reference: 10.1021/acs.jmedchem.5b01882
Chemical Information
| Molecular Formula | C20H16ClN3O2 |
| SMILEs | Cc1noc2c1-c1ccccc1C(c1ccc(Cl)cc1)=N[C@H]2CC(N)=O |
| InChI | InChI=1S/C20H16ClN3O2/c1-11-18-14-4-2-3-5-15(14)19(12-6-8-13(21)9-7-12)23-16(10-17(22)25)20(18)26-24-11/h2-9,16H,10H2,1H3,(H2,22,25)/t16-/m0/s1 |
| Molecular weight | 365.09 Da |
| AlogP | 4.070920000000003 |
| HBond acceptors | 5 |
| HBond donors | 2 |
| Atoms | 42 |