Probe Summary
| Targets | Biochemical/Biophysical Potency | Cellular Potency |
|---|---|---|
| CREBBP |
|
|
| EP300 |
|
|
Selectivity
Potency Cellular
In Vitro
Mode of Action: Degrader (PROTAC)
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1021/acs.jmedchem.3c02124
Mode of Action: Degrader (PROTAC)
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1021/acs.jmedchem.3c02124
In Vivo Validations
DOI Reference: 10.1021/acs.jmedchem.3c02124
DOI Reference: 10.1021/acs.jmedchem.3c02124
DOI Reference: 10.1021/acs.jmedchem.3c02124
DOI Reference: 10.1021/acs.jmedchem.3c02124
Chemical Information
| Molecular Formula | C44H47F2N9O5 |
| SMILEs | CC(=O)N1CCc2c(c(N3CCCc4cc(-c5cnn(C)c5)c(C(F)F)cc43)nn2[C@H]2CC[C@H](CN3Cc4cc5c(cc4C3)C(=O)N(C3CCC(=O)NC3=O)C5=O)CC2)C1 |
| InChI | InChI=1S/C44H47F2N9O5/c1-24(56)52-13-11-36-35(23-52)41(53-12-3-4-26-14-31(29-18-47-50(2)20-29)32(40(45)46)17-38(26)53)49-55(36)30-7-5-25(6-8-30)19-51-21-27-15-33-34(16-28(27)22-51)44(60)54(43(33)59)37-9-10-39(57)48-42(37)58/h14-18,20,25,30,37,40H,3-13,19,21-23H2,1-2H3,(H,48,57,58)/t25-,30-,37? |
| Molecular weight | 819.37 Da |
| AlogP | 5.358400000000005 |
| HBond acceptors | 14 |
| HBond donors | 1 |
| Atoms | 107 |
| PAINS * | Yes |
* This is an automated alert only, and may not necessarily indicate an issue with this probe. ( Learn more about PAINS )