Probe Summary
| Targets | Biochemical/Biophysical Potency | Cellular Potency |
|---|---|---|
| AKT1 |
|
|
| AKT2 |
| |
| AKT3 |
|
Selectivity
Potency Cellular
In Vitro
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1021/jm301762v
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1021/jm301762v
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1021/jm301762v
In Vivo Validations
DOI Reference: 10.1021/jm301762v
DOI Reference: 10.1021/jm301762v
DOI Reference: 10.1021/jm301762v
Chemical Information
| Molecular Formula | C21H25ClN6O2 |
| SMILEs | NC1(C(=O)N[C@@H](CCO)c2ccc(Cl)cc2)CCN(c2ncnc3[nH]ccc23)CC1 |
| InChI | InChI=1S/C21H25ClN6O2/c22-15-3-1-14(2-4-15)17(6-12-29)27-20(30)21(23)7-10-28(11-8-21)19-16-5-9-24-18(16)25-13-26-19/h1-5,9,13,17,29H,6-8,10-12,23H2,(H,27,30)(H,24,25,26)/t17-/m0/s1 |
| Molecular weight | 428.17 Da |
| AlogP | 2.1489000000000003 |
| HBond acceptors | 8 |
| HBond donors | 5 |
| Atoms | 55 |
Vendors
Note: This is not an exhaustive list and does not indicate endorsement by the portal.