Probe Summary
| Targets | Biochemical/Biophysical Potency | Cellular Potency |
|---|---|---|
| PLK1 |
| |
| PLK2 |
| |
| PLK3 |
|
Selectivity
Potency Cellular
In Vitro
Mode of Action: ATP competitive
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1016/j.cub.2006.12.037
Mode of Action: ATP competitive
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1016/j.cub.2006.12.037
Mode of Action: ATP competitive
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1016/j.cub.2006.12.037
Chemical Information
| Molecular Formula | C28H39N7O3 |
| SMILEs | CC[C@@H]1C(=O)N(C)c2cnc(Nc3ccc(C(=O)NC4CCN(C)CC4)cc3OC)nc2N1C1CCCC1 |
| InChI | InChI=1S/C28H39N7O3/c1-5-22-27(37)34(3)23-17-29-28(32-25(23)35(22)20-8-6-7-9-20)31-21-11-10-18(16-24(21)38-4)26(36)30-19-12-14-33(2)15-13-19/h10-11,16-17,19-20,22H,5-9,12-15H2,1-4H3,(H,30,36)(H,29,31,32)/t22-/m1/s1 |
| Molecular weight | 521.31 Da |
| AlogP | 3.5568 |
| HBond acceptors | 10 |
| HBond donors | 2 |
| Atoms | 77 |
References
Publications
Vendors
Note: This is not an exhaustive list and does not indicate endorsement by the portal.