Probe Summary
| Targets | Biochemical/Biophysical Potency | Cellular Potency |
|---|---|---|
| RPS6KA1 |
|
|
| RPS6KA2 |
|
|
| RPS6KA3 |
|
|
| RPS6KA6 |
|
|
Selectivity
Potency: IC50 - MST2 0.86 uM, GSK3 beta 1.59 uM, MARK3 2.20 uM, CSNK2A1 0.45 uM, AURKB 0.34 uM, PLK1 0.10 uM
Potency Cellular
In Vitro
Mode of Action: ATP competitive
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1042/BJ20061088
Mode of Action: ATP competitive
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1042/BJ20061088
Mode of Action: ATP competitive
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1042/BJ20061088
Mode of Action: ATP competitive
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1042/BJ20061088
Chemical Information
| Molecular Formula | C19H23F2N5O2 |
| SMILEs | CC(C)CCN1c2nc(Nc3cc(F)c(O)c(F)c3)ncc2N(C)C(=O)C1C |
| InChI | InChI=1S/C19H23F2N5O2/c1-10(2)5-6-26-11(3)18(28)25(4)15-9-22-19(24-17(15)26)23-12-7-13(20)16(27)14(21)8-12/h7-11,27H,5-6H2,1-4H3,(H,22,23,24) |
| Molecular weight | 391.18 Da |
| AlogP | 3.421400000000001 |
| HBond acceptors | 7 |
| HBond donors | 2 |
| Atoms | 51 |
Vendors
Note: This is not an exhaustive list and does not indicate endorsement by the portal.