Probe Summary
| Targets | Biochemical/Biophysical Potency | Cellular Potency |
|---|---|---|
| BRD1 |
|
|
| TAF1 |
|
|
| TAF1L |
|
Selectivity
Potency: Kd - 1,390 nM
Potency Cellular
In Vitro
Mode of Action: Antagonist
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1021/acs.jmedchem.7b00306
Mode of Action: Antagonist
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1021/acs.jmedchem.7b00306
Mode of Action: Antagonist
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1021/acs.jmedchem.7b00306
In Vivo Validations
DOI Reference: 10.1021/acs.jmedchem.7b00306
Negative Control Compounds
Chemical Information
| Molecular Formula | C25H23N3O4 |
| SMILEs | Cc1cc2c(cc1N1C(=O)c3cccc4c(CCCO)ccc(c34)C1=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C25H23N3O4/c1-14-12-20-21(27(3)25(32)26(20)2)13-19(14)28-23(30)17-8-4-7-16-15(6-5-11-29)9-10-18(22(16)17)24(28)31/h4,7-10,12-13,29H,5-6,11H2,1-3H3 |
| Molecular weight | 429.17 Da |
| AlogP | 0.0 |
| HBond acceptors | 7 |
| HBond donors | 1 |
| Atoms | 55 |
References
Publications
Vendors
Note: This is not an exhaustive list and does not indicate endorsement by the portal.