Probe Summary
| Targets | Biochemical/Biophysical Potency | Cellular Potency |
|---|---|---|
| BRD4 |
|
|
| BRD2 |
| |
| BRDT |
| |
| BRD3 |
|
Selectivity
Potency Cellular
In Vitro
Mode of Action: Bivalent BD1-BD2
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1021/acs.jmedchem.6b00070
Mode of Action: Bivalent BD1-BD2
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1021/acs.jmedchem.6b00070
Mode of Action: Bivalent BD1-BD2
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1021/acs.jmedchem.6b00070
Mode of Action: Bivalent BD1-BD2
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1021/acs.jmedchem.6b00070
In Vivo Validations
DOI Reference: 10.1021/acs.jmedchem.6b00070
DOI Reference: 10.1021/acs.jmedchem.6b00070
Chemical Information
| Molecular Formula | C25H33N7O3 |
| SMILEs | COc1nnc2ccc(N3CCC(c4ccc(OCCN5CCN(C)C(=O)[C@H]5C)cc4)CC3)nn12 |
| InChI | InChI=1S/C25H33N7O3/c1-18-24(33)29(2)14-15-30(18)16-17-35-21-6-4-19(5-7-21)20-10-12-31(13-11-20)23-9-8-22-26-27-25(34-3)32(22)28-23/h4-9,18,20H,10-17H2,1-3H3/t18-/m1/s1 |
| Molecular weight | 479.26 Da |
| AlogP | 0.0 |
| HBond acceptors | 10 |
| HBond donors | -- |
| Atoms | 68 |
References
Publications
Vendors
Note: This is not an exhaustive list and does not indicate endorsement by the portal.