Probe Summary
| Targets | Biochemical/Biophysical Potency | Cellular Potency |
|---|---|---|
| AURKA |
|
|
| AURKB |
|
|
| AURKC |
|
|
Selectivity
Gene ID: Q16539
Organism: Homo sapiens
Family: CMGC Ser/Thr protein kinase family
Potency: IC 50 - 53 nM
Potency Cellular
In Vitro
Mode of Action: ATP competitive
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1158/0008-5472.CAN-10-3001
Mode of Action: ATP competitive
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1158/0008-5472.CAN-10-3001
Mode of Action: ATP competitive
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1158/0008-5472.CAN-10-3001
In Vivo Validations
DOI Reference: 10.1158/0008-5472.CAN-10-3001
Chemical Information
| Molecular Formula | C28H21N7OS |
| SMILEs | Cc1csc(-c2nnc(Nc3ccc(Oc4ncccc4-c4ccnc(N)n4)cc3)c3ccccc23)c1 |
| InChI | InChI=1S/C28H21N7OS/c1-17-15-24(37-16-17)25-20-5-2-3-6-21(20)26(35-34-25)32-18-8-10-19(11-9-18)36-27-22(7-4-13-30-27)23-12-14-31-28(29)33-23/h2-16H,1H3,(H,32,35)(H2,29,31,33) |
| Molecular weight | 503.15 Da |
| AlogP | 6.63682 |
| HBond acceptors | 8 |
| HBond donors | 3 |
| Atoms | 58 |
Vendors
Note: This is not an exhaustive list and does not indicate endorsement by the portal.