Probe Summary
| Targets | Biochemical/Biophysical Potency | Cellular Potency |
|---|---|---|
| BACE1 |
|
|
| BACE2 |
|
|
Selectivity
Potency Cellular
In Vitro
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1021/acs.jmedchem.9b01034
Mode of Action: Inhibitor
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1021/acs.jmedchem.9b01034
In Vivo Validations
DOI Reference: 10.1021/acs.jmedchem.9b01034
DOI Reference: 10.1021/acs.jmedchem.9b01034
DOI Reference: 10.1021/acs.jmedchem.9b01034
DOI Reference: 10.1021/acs.jmedchem.9b01034
DOI Reference: 10.1021/acs.jmedchem.9b01034
DOI Reference: 10.1021/acs.jmedchem.9b01034
Chemical Information
| Molecular Formula | C22H21F2N5O3S |
| SMILEs | C#CCOc1cnc(C(=O)Nc2cc(F)c(F)c([C@@]3(C)N=C(N)S[C@@]4(COC)C[C@H]43)c2)cn1 |
| InChI | InChI=1S/C22H21F2N5O3S/c1-4-5-32-17-10-26-15(9-27-17)19(30)28-12-6-13(18(24)14(23)7-12)21(2)16-8-22(16,11-31-3)33-20(25)29-21/h1,6-7,9-10,16H,5,8,11H2,2-3H3,(H2,25,29)(H,28,30)/t16-,21+,22+/m0/s1 |
| Molecular weight | 473.13 Da |
| AlogP | 2.7009000000000007 |
| HBond acceptors | 8 |
| HBond donors | 3 |
| Atoms | 54 |
Vendors
Note: This is not an exhaustive list and does not indicate endorsement by the portal.