Probe Summary
| Targets | Biochemical/Biophysical Potency | Cellular Potency |
|---|---|---|
| PTPN2 |
|
|
| PTPN1 |
|
Selectivity
Gene ID: P43378
Organism: Homo sapiens
Family: protein-tyrosine phosphatase family
Potency: IC50 - 15 nM
Potency Cellular
In Vitro
Mode of Action: Competitive, reversible
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1038/s41586-023-06575-7
Mode of Action: Competitive, reversible
Structure-Activity-Relationship data available? Yes
DOI Reference: 10.1038/s41586-023-06575-7
In Vivo Validations
DOI Reference: 10.1038/s41586-023-06575-7
Chemical Information
| Molecular Formula | C17H24FN3O4S |
| SMILEs | CC(C)CCN[C@@H]1CCc2cc(O)c(N3CC(=O)NS3(=O)=O)c(F)c2C1 |
| InChI | InChI=1S/C17H24FN3O4S/c1-10(2)5-6-19-12-4-3-11-7-14(22)17(16(18)13(11)8-12)21-9-15(23)20-26(21,24)25/h7,10,12,19,22H,3-6,8-9H2,1-2H3,(H,20,23)/t12-/m1/s1 |
| Molecular weight | 385.15 Da |
| AlogP | 0.0 |
| HBond acceptors | 7 |
| HBond donors | 3 |
| Atoms | 50 |
Vendors
Note: This is not an exhaustive list and does not indicate endorsement by the portal.